C31H46N2O4S — CID 101211219
[(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 2-benzyliminoacetate (PubChem CID 101211219) has the molecular formula C31H46N2O4S and a molecular weight of 542.79 g/mol. Its IUPAC name is [(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 2-benzyliminoacetate.
| Compound Name | [(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 2-benzyliminoacetate |
|---|---|
| PubChem CID | 101211219 |
| Molecular Formula | C31H46N2O4S |
| Molecular Weight | 542.79 g/mol |
| Exact Mass | 542.32 |
| IUPAC Name | [(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 2-benzyliminoacetate |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(CS(=O)(=O)N(C1CCCCC1)C1CCCCC1)[C@H](OC(=O)/C=N/Cc1ccccc1)C2 |
| InChI | InChI=1S/C31H46N2O4S/c1-30(2)25-18-19-31(30,28(20-25)37-29(34)22-32-21-24-12-6-3-7-13-24)23-38(35,36)33(26-14-8-4-9-15-26)27-16-10-5-11-17-27/h3,6-7,12-13,22,25-28H,4-5,8-11,14-21,23H2,1-2H3/b32-22+/t25-,28-,31-/m1/s1 |
| InChIKey | FPDLWNMPKPRFKX-JNAZMAHLSA-N |
| XLogP | 6.29 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.79 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|