C30H44N3O4S+ — CID 10075996
(E)-2-[[(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl]oxy]-2-hydroxy-1-phenylethenediazonium (PubChem CID 10075996) has the molecular formula C30H44N3O4S+ and a molecular weight of 542.77 g/mol. Its IUPAC name is (E)-2-[[(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl]oxy]-2-hydroxy-1-phenylethenediazonium.
| Compound Name | (E)-2-[[(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl]oxy]-2-hydroxy-1-phenylethenediazonium |
|---|---|
| PubChem CID | 10075996 |
| Molecular Formula | C30H44N3O4S+ |
| Molecular Weight | 542.77 g/mol |
| Exact Mass | 542.30 |
| IUPAC Name | (E)-2-[[(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl]oxy]-2-hydroxy-1-phenylethenediazonium |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(CS(=O)(=O)N(C1CCCCC1)C1CCCCC1)[C@H](O/C(O)=C(/[N+]#N)c1ccccc1)C2 |
| InChI | InChI=1S/C30H43N3O4S/c1-29(2)23-18-19-30(29,26(20-23)37-28(34)27(32-31)22-12-6-3-7-13-22)21-38(35,36)33(24-14-8-4-9-15-24)25-16-10-5-11-17-25/h3,6-7,12-13,23-26H,4-5,8-11,14-21H2,1-2H3/p+1/b28-27+/t23-,26-,30-/m1/s1 |
| InChIKey | GOBSFHFMIPBBKI-UKUXJZAYSA-O |
| XLogP | 7.23 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.77 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|