C38H63NO4SSi — CID 11093554
1-[(1S,2R,4R)-2-[(E,3R)-1-[tert-butyl(dimethyl)silyl]oxy-3-phenylbut-1-enoxy]-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]-N,N-dicyclohexylmethanesulfonamide (PubChem CID 11093554) has the molecular formula C38H63NO4SSi and a molecular weight of 658.08 g/mol. Its IUPAC name is 1-[(1S,2R,4R)-2-[(E,3R)-1-[tert-butyl(dimethyl)silyl]oxy-3-phenylbut-1-enoxy]-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]-N,N-dicyclohexylmethanesulfonamide.
| Compound Name | 1-[(1S,2R,4R)-2-[(E,3R)-1-[tert-butyl(dimethyl)silyl]oxy-3-phenylbut-1-enoxy]-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]-N,N-dicyclohexylmethanesulfonamide |
|---|---|
| PubChem CID | 11093554 |
| Molecular Formula | C38H63NO4SSi |
| Molecular Weight | 658.08 g/mol |
| Exact Mass | 657.42 |
| IUPAC Name | 1-[(1S,2R,4R)-2-[(E,3R)-1-[tert-butyl(dimethyl)silyl]oxy-3-phenylbut-1-enoxy]-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]-N,N-dicyclohexylmethanesulfonamide |
| SMILES | C[C@H](/C=C(\O[C@@H]1C[C@H]2CC[C@]1(CS(=O)(=O)N(C1CCCCC1)C1CCCCC1)C2(C)C)O[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C38H63NO4SSi/c1-29(30-18-12-9-13-19-30)26-35(43-45(7,8)36(2,3)4)42-34-27-31-24-25-38(34,37(31,5)6)28-44(40,41)39(32-20-14-10-15-21-32)33-22-16-11-17-23-33/h9,12-13,18-19,26,29,31-34H,10-11,14-17,20-25,27-28H2,1-8H3/b35-26+/t29-,31-,34-,38-/m1/s1 |
| InChIKey | SQDLQCARCMJEOO-DOTAOKLYSA-N |
| XLogP | 10.16 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.08 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|