C26H31NO5S — CID 102305019
[(1S,2R,4R)-1-(dibenzylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 2-oxoacetate (PubChem CID 102305019) has the molecular formula C26H31NO5S and a molecular weight of 469.60 g/mol. Its IUPAC name is [(1S,2R,4R)-1-(dibenzylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 2-oxoacetate.
| Compound Name | [(1S,2R,4R)-1-(dibenzylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 2-oxoacetate |
|---|---|
| PubChem CID | 102305019 |
| Molecular Formula | C26H31NO5S |
| Molecular Weight | 469.60 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | [(1S,2R,4R)-1-(dibenzylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 2-oxoacetate |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(CS(=O)(=O)N(Cc1ccccc1)Cc1ccccc1)[C@H](OC(=O)C=O)C2 |
| InChI | InChI=1S/C26H31NO5S/c1-25(2)22-13-14-26(25,23(15-22)32-24(29)18-28)19-33(30,31)27(16-20-9-5-3-6-10-20)17-21-11-7-4-8-12-21/h3-12,18,22-23H,13-17,19H2,1-2H3/t22-,23-,26-/m1/s1 |
| InChIKey | DMQXNQZMVLHGCU-JQYIIUTOSA-N |
| XLogP | 3.96 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.60 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|