C28H37NO7S2 — CID 10793041
[(1'R,2R,4R,4'S)-1'-(dibenzylsulfamoylmethyl)-7',7'-dimethylspiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-4-yl]methyl methanesulfonate (PubChem CID 10793041) has the molecular formula C28H37NO7S2 and a molecular weight of 563.74 g/mol. Its IUPAC name is [(1'R,2R,4R,4'S)-1'-(dibenzylsulfamoylmethyl)-7',7'-dimethylspiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-4-yl]methyl methanesulfonate.
| Compound Name | [(1'R,2R,4R,4'S)-1'-(dibenzylsulfamoylmethyl)-7',7'-dimethylspiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-4-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 10793041 |
| Molecular Formula | C28H37NO7S2 |
| Molecular Weight | 563.74 g/mol |
| Exact Mass | 563.20 |
| IUPAC Name | [(1'R,2R,4R,4'S)-1'-(dibenzylsulfamoylmethyl)-7',7'-dimethylspiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-4-yl]methyl methanesulfonate |
| SMILES | CC1(C)[C@H]2CC[C@]1(CS(=O)(=O)N(Cc1ccccc1)Cc1ccccc1)[C@]1(C2)OC[C@H](COS(C)(=O)=O)O1 |
| InChI | InChI=1S/C28H37NO7S2/c1-26(2)24-14-15-27(26,28(16-24)34-19-25(36-28)20-35-37(3,30)31)21-38(32,33)29(17-22-10-6-4-7-11-22)18-23-12-8-5-9-13-23/h4-13,24-25H,14-21H2,1-3H3/t24-,25+,27+,28+/m0/s1 |
| InChIKey | VGEDNYNGKYJPFX-PAVXMLEDSA-N |
| XLogP | 3.93 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.74 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|