C27H35NO5S — CID 11799109
N,N-dibenzyl-1-[(1'R,2R,4S,4'S)-4-(hydroxymethyl)-7',7'-dimethylspiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-1'-yl]methanesulfonamide (PubChem CID 11799109) has the molecular formula C27H35NO5S and a molecular weight of 485.65 g/mol. Its IUPAC name is N,N-dibenzyl-1-[(1'R,2R,4S,4'S)-4-(hydroxymethyl)-7',7'-dimethylspiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-1'-yl]methanesulfonamide.
| Compound Name | N,N-dibenzyl-1-[(1'R,2R,4S,4'S)-4-(hydroxymethyl)-7',7'-dimethylspiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-1'-yl]methanesulfonamide |
|---|---|
| PubChem CID | 11799109 |
| Molecular Formula | C27H35NO5S |
| Molecular Weight | 485.65 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | N,N-dibenzyl-1-[(1'R,2R,4S,4'S)-4-(hydroxymethyl)-7',7'-dimethylspiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-1'-yl]methanesulfonamide |
| SMILES | CC1(C)[C@H]2CC[C@]1(CS(=O)(=O)N(Cc1ccccc1)Cc1ccccc1)[C@]1(C2)OC[C@H](CO)O1 |
| InChI | InChI=1S/C27H35NO5S/c1-25(2)23-13-14-26(25,27(15-23)32-19-24(18-29)33-27)20-34(30,31)28(16-21-9-5-3-6-10-21)17-22-11-7-4-8-12-22/h3-12,23-24,29H,13-20H2,1-2H3/t23-,24-,26+,27+/m0/s1 |
| InChIKey | ROIKLZSJAKINOW-ADUOGZPQSA-N |
| XLogP | 3.95 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.65 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |