C30H43N2O4S+ — CID 10817687
[(1'R,2R,4S,4'S)-1'-(dibenzylsulfamoylmethyl)-7',7'-dimethylspiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-4-yl]methyl-trimethylazanium (PubChem CID 10817687) has the molecular formula C30H43N2O4S+ and a molecular weight of 527.75 g/mol. Its IUPAC name is [(1'R,2R,4S,4'S)-1'-(dibenzylsulfamoylmethyl)-7',7'-dimethylspiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-4-yl]methyl-trimethylazanium.
| Compound Name | [(1'R,2R,4S,4'S)-1'-(dibenzylsulfamoylmethyl)-7',7'-dimethylspiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-4-yl]methyl-trimethylazanium |
|---|---|
| PubChem CID | 10817687 |
| Molecular Formula | C30H43N2O4S+ |
| Molecular Weight | 527.75 g/mol |
| Exact Mass | 527.29 |
| IUPAC Name | [(1'R,2R,4S,4'S)-1'-(dibenzylsulfamoylmethyl)-7',7'-dimethylspiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-4-yl]methyl-trimethylazanium |
| SMILES | CC1(C)[C@H]2CC[C@]1(CS(=O)(=O)N(Cc1ccccc1)Cc1ccccc1)[C@]1(C2)OC[C@H](C[N+](C)(C)C)O1 |
| InChI | InChI=1S/C30H43N2O4S/c1-28(2)26-16-17-29(28,30(18-26)35-22-27(36-30)21-32(3,4)5)23-37(33,34)31(19-24-12-8-6-9-13-24)20-25-14-10-7-11-15-25/h6-15,26-27H,16-23H2,1-5H3/q+1/t26-,27-,29+,30+/m0/s1 |
| InChIKey | IESWLQXVUXTZPP-BPYIEZMESA-N |
| XLogP | 4.66 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.75 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|