C31H46N2O7S2 — CID 10817686
[(1'R,2R,4S,4'S)-1'-(dibenzylsulfamoylmethyl)-7',7'-dimethylspiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-4-yl]methyl-trimethylazanium;methanesulfonate (PubChem CID 10817686) has the molecular formula C31H46N2O7S2 and a molecular weight of 622.85 g/mol. Its IUPAC name is [(1'R,2R,4S,4'S)-1'-(dibenzylsulfamoylmethyl)-7',7'-dimethylspiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-4-yl]methyl-trimethylazanium;methanesulfonate.
| Compound Name | [(1'R,2R,4S,4'S)-1'-(dibenzylsulfamoylmethyl)-7',7'-dimethylspiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-4-yl]methyl-trimethylazanium;methanesulfonate |
|---|---|
| PubChem CID | 10817686 |
| Molecular Formula | C31H46N2O7S2 |
| Molecular Weight | 622.85 g/mol |
| Exact Mass | 622.27 |
| IUPAC Name | [(1'R,2R,4S,4'S)-1'-(dibenzylsulfamoylmethyl)-7',7'-dimethylspiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-4-yl]methyl-trimethylazanium;methanesulfonate |
| SMILES | CC1(C)[C@H]2CC[C@]1(CS(=O)(=O)N(Cc1ccccc1)Cc1ccccc1)[C@]1(C2)OC[C@H](C[N+](C)(C)C)O1.CS(=O)(=O)[O-] |
| InChI | InChI=1S/C30H43N2O4S.CH4O3S/c1-28(2)26-16-17-29(28,30(18-26)35-22-27(36-30)21-32(3,4)5)23-37(33,34)31(19-24-12-8-6-9-13-24)20-25-14-10-7-11-15-25;1-5(2,3)4/h6-15,26-27H,16-23H2,1-5H3;1H3,(H,2,3,4)/q+1;/p-1/t26-,27-,29+,30+;/m0./s1 |
| InChIKey | XLVRFYCQJRVGPM-GRLLHLTGSA-M |
| XLogP | 3.82 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.85 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|