C26H33NO4S — CID 18654637
N,N-dibenzyl-1-[(1S,2S,4S,6S,7S)-4-hydroxy-10,10-dimethyl-3-oxatricyclo[5.2.1.02,6]decan-1-yl]methanesulfonamide (PubChem CID 18654637) has the molecular formula C26H33NO4S and a molecular weight of 455.62 g/mol. Its IUPAC name is N,N-dibenzyl-1-[(1S,2S,4S,6S,7S)-4-hydroxy-10,10-dimethyl-3-oxatricyclo[5.2.1.02,6]decan-1-yl]methanesulfonamide.
| Compound Name | N,N-dibenzyl-1-[(1S,2S,4S,6S,7S)-4-hydroxy-10,10-dimethyl-3-oxatricyclo[5.2.1.02,6]decan-1-yl]methanesulfonamide |
|---|---|
| PubChem CID | 18654637 |
| Molecular Formula | C26H33NO4S |
| Molecular Weight | 455.62 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | N,N-dibenzyl-1-[(1S,2S,4S,6S,7S)-4-hydroxy-10,10-dimethyl-3-oxatricyclo[5.2.1.02,6]decan-1-yl]methanesulfonamide |
| SMILES | CC1(C)[C@H]2CC[C@@]1(CS(=O)(=O)N(Cc1ccccc1)Cc1ccccc1)[C@H]1O[C@H](O)C[C@@H]21 |
| InChI | InChI=1S/C26H33NO4S/c1-25(2)22-13-14-26(25,24-21(22)15-23(28)31-24)18-32(29,30)27(16-19-9-5-3-6-10-19)17-20-11-7-4-8-12-20/h3-12,21-24,28H,13-18H2,1-2H3/t21-,22-,23-,24-,26+/m0/s1 |
| InChIKey | AQERAAKVFTYGFY-MDLKPKIOSA-N |
| XLogP | 4.18 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.62 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |