C41H64O9Si2 — CID 10417641
[(1S,2S,4S,7R,9S,10S,15S)-4-acetyloxy-1-hydroxy-10,14,17,17-tetramethyl-11-oxo-9,15-bis(triethylsilyloxy)-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate (PubChem CID 10417641) has the molecular formula C41H64O9Si2 and a molecular weight of 757.13 g/mol. Its IUPAC name is [(1S,2S,4S,7R,9S,10S,15S)-4-acetyloxy-1-hydroxy-10,14,17,17-tetramethyl-11-oxo-9,15-bis(triethylsilyloxy)-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate.
| Compound Name | [(1S,2S,4S,7R,9S,10S,15S)-4-acetyloxy-1-hydroxy-10,14,17,17-tetramethyl-11-oxo-9,15-bis(triethylsilyloxy)-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
|---|---|
| PubChem CID | 10417641 |
| Molecular Formula | C41H64O9Si2 |
| Molecular Weight | 757.13 g/mol |
| Exact Mass | 756.41 |
| IUPAC Name | [(1S,2S,4S,7R,9S,10S,15S)-4-acetyloxy-1-hydroxy-10,14,17,17-tetramethyl-11-oxo-9,15-bis(triethylsilyloxy)-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
| SMILES | CC[Si](CC)(CC)O[C@H]1C[C@@]2(O)C(OC(=O)c3ccccc3)C3[C@](C)(C(=O)CC(=C1C)C2(C)C)[C@@H](O[Si](CC)(CC)CC)C[C@H]1OC[C@@]31OC(C)=O |
| InChI | InChI=1S/C41H64O9Si2/c1-12-51(13-2,14-3)49-31-25-41(45)36(47-37(44)29-21-19-18-20-22-29)35-39(11,32(43)23-30(27(31)7)38(41,9)10)33(50-52(15-4,16-5)17-6)24-34-40(35,26-46-34)48-28(8)42/h18-22,31,33-36,45H,12-17,23-26H2,1-11H3/t31-,33-,34+,35?,36?,39+,40-,41+/m0/s1 |
| InChIKey | CKADZWMQXSPTAI-CLUBFOPYSA-N |
| XLogP | 8.17 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.13 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|