C10H14N2O2 — CID 10420180
(3,5,6-trimethyl(115N)pyrazin-2-yl)methyl acetate (PubChem CID 10420180) has the molecular formula C10H14N2O2 and a molecular weight of 195.23 g/mol. Its IUPAC name is (3,5,6-trimethyl(115N)pyrazin-2-yl)methyl acetate.
| Compound Name | (3,5,6-trimethyl(115N)pyrazin-2-yl)methyl acetate |
|---|---|
| PubChem CID | 10420180 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 195.23 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | (3,5,6-trimethyl(115N)pyrazin-2-yl)methyl acetate |
| SMILES | CC(=O)OCc1[15n]c(C)c(C)nc1C |
| InChI | InChI=1S/C10H14N2O2/c1-6-7(2)12-10(8(3)11-6)5-14-9(4)13/h5H2,1-4H3/i12+1 |
| InChIKey | ANFZDGQJMXVAEI-HNHCFKFXSA-N |
| XLogP | 1.46 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.23 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |