C14H24N2 — CID 10421037
5-butyl-N,N-diethyl-3H-azepin-2-amine (PubChem CID 10421037) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is 5-butyl-N,N-diethyl-3H-azepin-2-amine.
| Compound Name | 5-butyl-N,N-diethyl-3H-azepin-2-amine |
|---|---|
| PubChem CID | 10421037 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | 5-butyl-N,N-diethyl-3H-azepin-2-amine |
| SMILES | CCCCC1=CCC(N(CC)CC)=NC=C1 |
| InChI | InChI=1S/C14H24N2/c1-4-7-8-13-9-10-14(15-12-11-13)16(5-2)6-3/h9,11-12H,4-8,10H2,1-3H3 |
| InChIKey | PJYYWSGGBOCOBY-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |