C14H24N2 — CID 4192093
4-tert-butyl-N,N-diethyl-3H-azepin-2-amine (PubChem CID 4192093) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is 4-tert-butyl-N,N-diethyl-3H-azepin-2-amine.
| Compound Name | 4-tert-butyl-N,N-diethyl-3H-azepin-2-amine |
|---|---|
| PubChem CID | 4192093 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | 4-tert-butyl-N,N-diethyl-3H-azepin-2-amine |
| SMILES | CCN(CC)C1=NC=CC=C(C(C)(C)C)C1 |
| InChI | InChI=1S/C14H24N2/c1-6-16(7-2)13-11-12(14(3,4)5)9-8-10-15-13/h8-10H,6-7,11H2,1-5H3 |
| InChIKey | WYQVNXCVEXGKRR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |