C11H16N2 — CID 10397320
1-ethyl-2,3,4,4a-tetrahydropyrido[2,3-b]azepine (PubChem CID 10397320) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 1-ethyl-2,3,4,4a-tetrahydropyrido[2,3-b]azepine.
| Compound Name | 1-ethyl-2,3,4,4a-tetrahydropyrido[2,3-b]azepine |
|---|---|
| PubChem CID | 10397320 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 1-ethyl-2,3,4,4a-tetrahydropyrido[2,3-b]azepine |
| SMILES | CCN1CCCC2C=CC=CN=C21 |
| InChI | InChI=1S/C11H16N2/c1-2-13-9-5-7-10-6-3-4-8-12-11(10)13/h3-4,6,8,10H,2,5,7,9H2,1H3 |
| InChIKey | LAMHAMPVNYEVFT-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |