C19H32N2 — CID 126516250
(E,2E)-N-ethenyl-2-ethylidene-1-[(2S)-2-methylpiperidin-1-yl]-3-propan-2-ylhex-3-en-1-imine (PubChem CID 126516250) has the molecular formula C19H32N2 and a molecular weight of 288.48 g/mol. Its IUPAC name is (E,2E)-N-ethenyl-2-ethylidene-1-[(2S)-2-methylpiperidin-1-yl]-3-propan-2-ylhex-3-en-1-imine.
| Compound Name | (E,2E)-N-ethenyl-2-ethylidene-1-[(2S)-2-methylpiperidin-1-yl]-3-propan-2-ylhex-3-en-1-imine |
|---|---|
| PubChem CID | 126516250 |
| Molecular Formula | C19H32N2 |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.26 |
| IUPAC Name | (E,2E)-N-ethenyl-2-ethylidene-1-[(2S)-2-methylpiperidin-1-yl]-3-propan-2-ylhex-3-en-1-imine |
| SMILES | C=C/N=C(C(=C/C)/C(=C/CC)C(C)C)\N1CCCC[C@@H]1C |
| InChI | InChI=1S/C19H32N2/c1-7-12-18(15(4)5)17(8-2)19(20-9-3)21-14-11-10-13-16(21)6/h8-9,12,15-16H,3,7,10-11,13-14H2,1-2,4-6H3/b17-8+,18-12+,20-19-/t16-/m0/s1 |
| InChIKey | MYKIMPGCBDQBIT-FCIYIVIFSA-N |
| XLogP | 5.34 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|