C20H27N3 — CID 123841838
N-(2-ethylidene-5-methylhexa-3,5-dienyl)-7,10-dimethyl-8,9-dihydro-7H-pyrazino[1,2-a]azepin-6-imine (PubChem CID 123841838) has the molecular formula C20H27N3 and a molecular weight of 309.46 g/mol. Its IUPAC name is N-(2-ethylidene-5-methylhexa-3,5-dienyl)-7,10-dimethyl-8,9-dihydro-7H-pyrazino[1,2-a]azepin-6-imine.
| Compound Name | N-(2-ethylidene-5-methylhexa-3,5-dienyl)-7,10-dimethyl-8,9-dihydro-7H-pyrazino[1,2-a]azepin-6-imine |
|---|---|
| PubChem CID | 123841838 |
| Molecular Formula | C20H27N3 |
| Molecular Weight | 309.46 g/mol |
| Exact Mass | 309.22 |
| IUPAC Name | N-(2-ethylidene-5-methylhexa-3,5-dienyl)-7,10-dimethyl-8,9-dihydro-7H-pyrazino[1,2-a]azepin-6-imine |
| SMILES | C=C(C)C=CC(=CC)C/N=C1\C(C)CCC(C)=C2C=NC=CN21 |
| InChI | InChI=1S/C20H27N3/c1-6-18(10-7-15(2)3)13-22-20-17(5)9-8-16(4)19-14-21-11-12-23(19)20/h6-7,10-12,14,17H,2,8-9,13H2,1,3-5H3/b10-7?,18-6?,22-20+ |
| InChIKey | NVJKXEYHORHTFE-MSRKVWNRSA-N |
| XLogP | 5.03 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.46 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|