C18H25N3 — CID 123806707
N'-ethenyl-N-methyl-N-[3-[1-(2-methylcyclohexa-2,4-dien-1-yl)ethenyliminomethyl]but-3-en-2-yl]methanimidamide (PubChem CID 123806707) has the molecular formula C18H25N3 and a molecular weight of 283.42 g/mol. Its IUPAC name is N'-ethenyl-N-methyl-N-[3-[1-(2-methylcyclohexa-2,4-dien-1-yl)ethenyliminomethyl]but-3-en-2-yl]methanimidamide.
| Compound Name | N'-ethenyl-N-methyl-N-[3-[1-(2-methylcyclohexa-2,4-dien-1-yl)ethenyliminomethyl]but-3-en-2-yl]methanimidamide |
|---|---|
| PubChem CID | 123806707 |
| Molecular Formula | C18H25N3 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.20 |
| IUPAC Name | N'-ethenyl-N-methyl-N-[3-[1-(2-methylcyclohexa-2,4-dien-1-yl)ethenyliminomethyl]but-3-en-2-yl]methanimidamide |
| SMILES | C=C/N=C/N(C)C(C)C(=C)/C=N/C(=C)C1CC=CC=C1C |
| InChI | InChI=1S/C18H25N3/c1-7-19-13-21(6)17(5)15(3)12-20-16(4)18-11-9-8-10-14(18)2/h7-10,12-13,17-18H,1,3-4,11H2,2,5-6H3/b19-13+,20-12+ |
| InChIKey | QSOMXFXIVWNWID-JUARGUKUSA-N |
| XLogP | 4.14 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|