C20H30N2 — CID 91598723
N-cyclohexyl-2-ethylidene-3-methyl-1-(2-methylidene-1-pyridinyl)pentan-1-imine (PubChem CID 91598723) has the molecular formula C20H30N2 and a molecular weight of 298.47 g/mol. Its IUPAC name is N-cyclohexyl-2-ethylidene-3-methyl-1-(2-methylidene-1-pyridinyl)pentan-1-imine.
| Compound Name | N-cyclohexyl-2-ethylidene-3-methyl-1-(2-methylidene-1-pyridinyl)pentan-1-imine |
|---|---|
| PubChem CID | 91598723 |
| Molecular Formula | C20H30N2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.24 |
| IUPAC Name | N-cyclohexyl-2-ethylidene-3-methyl-1-(2-methylidene-1-pyridinyl)pentan-1-imine |
| SMILES | C=C1C=CC=CN1/C(=N/C1CCCCC1)C(=CC)C(C)CC |
| InChI | InChI=1S/C20H30N2/c1-5-16(3)19(6-2)20(21-18-13-8-7-9-14-18)22-15-11-10-12-17(22)4/h6,10-12,15-16,18H,4-5,7-9,13-14H2,1-3H3/b19-6?,21-20+ |
| InChIKey | OBHCQUULEYWVAD-GFFDTHOUSA-N |
| XLogP | 5.61 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|