C33H48N4 — CID 142511111
(Z)-3,4-dimethyloct-4-ene;(2E)-N,3,4-trimethyl-1-[7-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-4-methylidenepyrido[1,2-a]pyrimidin-2-yl]penta-2,4-dien-1-imine (PubChem CID 142511111) has the molecular formula C33H48N4 and a molecular weight of 500.78 g/mol. Its IUPAC name is (Z)-3,4-dimethyloct-4-ene;(2E)-N,3,4-trimethyl-1-[7-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-4-methylidenepyrido[1,2-a]pyrimidin-2-yl]penta-2,4-dien-1-imine.
| Compound Name | (Z)-3,4-dimethyloct-4-ene;(2E)-N,3,4-trimethyl-1-[7-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-4-methylidenepyrido[1,2-a]pyrimidin-2-yl]penta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 142511111 |
| Molecular Formula | C33H48N4 |
| Molecular Weight | 500.78 g/mol |
| Exact Mass | 500.39 |
| IUPAC Name | (Z)-3,4-dimethyloct-4-ene;(2E)-N,3,4-trimethyl-1-[7-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-4-methylidenepyrido[1,2-a]pyrimidin-2-yl]penta-2,4-dien-1-imine |
| SMILES | C=C(C)/C(C)=C/C(=N\C)C1=CC(=C)N2C=C(C3=CCN(C)CC3)C=CC2=N1.CCC/C=C(/C)C(C)CC |
| InChI | InChI=1S/C23H28N4.C10H20/c1-16(2)17(3)13-21(24-5)22-14-18(4)27-15-20(7-8-23(27)25-22)19-9-11-26(6)12-10-19;1-5-7-8-10(4)9(3)6-2/h7-9,13-15H,1,4,10-12H2,2-3,5-6H3;8-9H,5-7H2,1-4H3/b17-13+,24-21+;10-8- |
| InChIKey | LSPIYGRMSNBSDU-HOILMHMWSA-N |
| XLogP | 8.19 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.78 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|