C26H38N4 — CID 91539516
(7Z)-8-[(1,6-dimethyl-2,3-dihydropyridin-4-ylidene)amino]-N,N,5-trimethyl-6-[2-(5-methylcyclohexa-1,5-dien-1-yl)ethenyl]-3,4,5,6-tetrahydroazocin-2-amine (PubChem CID 91539516) has the molecular formula C26H38N4 and a molecular weight of 406.62 g/mol. Its IUPAC name is (7Z)-8-[(1,6-dimethyl-2,3-dihydropyridin-4-ylidene)amino]-N,N,5-trimethyl-6-[2-(5-methylcyclohexa-1,5-dien-1-yl)ethenyl]-3,4,5,6-tetrahydroazocin-2-amine.
| Compound Name | (7Z)-8-[(1,6-dimethyl-2,3-dihydropyridin-4-ylidene)amino]-N,N,5-trimethyl-6-[2-(5-methylcyclohexa-1,5-dien-1-yl)ethenyl]-3,4,5,6-tetrahydroazocin-2-amine |
|---|---|
| PubChem CID | 91539516 |
| Molecular Formula | C26H38N4 |
| Molecular Weight | 406.62 g/mol |
| Exact Mass | 406.31 |
| IUPAC Name | (7Z)-8-[(1,6-dimethyl-2,3-dihydropyridin-4-ylidene)amino]-N,N,5-trimethyl-6-[2-(5-methylcyclohexa-1,5-dien-1-yl)ethenyl]-3,4,5,6-tetrahydroazocin-2-amine |
| SMILES | CC1=CC(C=CC2/C=C(/N=C3C=C(C)N(C)CC3)N=C(N(C)C)CCC2C)=CCC1 |
| InChI | InChI=1S/C26H38N4/c1-19-8-7-9-22(16-19)11-12-23-18-25(27-24-14-15-30(6)21(3)17-24)28-26(29(4)5)13-10-20(23)2/h9,11-12,16-18,20,23H,7-8,10,13-15H2,1-6H3/b12-11?,25-18-,27-24?,28-26? |
| InChIKey | CYAZDDOGJPZASQ-UJPNACCKSA-N |
| XLogP | 5.74 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.62 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|