C34H46N4 — CID 142511168
4-cyclobutylidene-2-[(3E,5E,10Z)-2-ethyl-3,11-dimethyl-1-azacycloundeca-1,3,5,10-tetraen-5-yl]-7-(4-methylazocan-1-yl)pyrido[1,2-a]pyrimidine (PubChem CID 142511168) has the molecular formula C34H46N4 and a molecular weight of 510.77 g/mol. Its IUPAC name is 4-cyclobutylidene-2-[(3E,5E,10Z)-2-ethyl-3,11-dimethyl-1-azacycloundeca-1,3,5,10-tetraen-5-yl]-7-(4-methylazocan-1-yl)pyrido[1,2-a]pyrimidine.
| Compound Name | 4-cyclobutylidene-2-[(3E,5E,10Z)-2-ethyl-3,11-dimethyl-1-azacycloundeca-1,3,5,10-tetraen-5-yl]-7-(4-methylazocan-1-yl)pyrido[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 142511168 |
| Molecular Formula | C34H46N4 |
| Molecular Weight | 510.77 g/mol |
| Exact Mass | 510.37 |
| IUPAC Name | 4-cyclobutylidene-2-[(3E,5E,10Z)-2-ethyl-3,11-dimethyl-1-azacycloundeca-1,3,5,10-tetraen-5-yl]-7-(4-methylazocan-1-yl)pyrido[1,2-a]pyrimidine |
| SMILES | CCC1=N/C(C)=C\CCC/C=C(C2=CC(=C3CCC3)N3C=C(N4CCCCC(C)CC4)C=CC3=N2)\C=C\1C |
| InChI | InChI=1S/C34H46N4/c1-5-31-26(3)22-29(14-8-6-7-13-27(4)35-31)32-23-33(28-15-11-16-28)38-24-30(17-18-34(38)36-32)37-20-10-9-12-25(2)19-21-37/h13-14,17-18,22-25H,5-12,15-16,19-21H2,1-4H3/b26-22+,27-13-,29-14+,35-31- |
| InChIKey | BWBQXTFLMTWCMK-WHCGWYRLSA-N |
| XLogP | 8.76 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.77 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |