C38H57FN4 — CID 142511334
(E)-1-[4-cyclobutylidene-7-[1-(2-fluoroethyl)piperidin-4-yl]pyrido[1,2-a]pyrimidin-2-yl]-N,3-dimethyl-4-methylidenehex-2-en-1-imine;(Z)-3,4-dimethyloct-4-ene (PubChem CID 142511334) has the molecular formula C38H57FN4 and a molecular weight of 588.90 g/mol. Its IUPAC name is (E)-1-[4-cyclobutylidene-7-[1-(2-fluoroethyl)piperidin-4-yl]pyrido[1,2-a]pyrimidin-2-yl]-N,3-dimethyl-4-methylidenehex-2-en-1-imine;(Z)-3,4-dimethyloct-4-ene.
| Compound Name | (E)-1-[4-cyclobutylidene-7-[1-(2-fluoroethyl)piperidin-4-yl]pyrido[1,2-a]pyrimidin-2-yl]-N,3-dimethyl-4-methylidenehex-2-en-1-imine;(Z)-3,4-dimethyloct-4-ene |
|---|---|
| PubChem CID | 142511334 |
| Molecular Formula | C38H57FN4 |
| Molecular Weight | 588.90 g/mol |
| Exact Mass | 588.46 |
| IUPAC Name | (E)-1-[4-cyclobutylidene-7-[1-(2-fluoroethyl)piperidin-4-yl]pyrido[1,2-a]pyrimidin-2-yl]-N,3-dimethyl-4-methylidenehex-2-en-1-imine;(Z)-3,4-dimethyloct-4-ene |
| SMILES | C=C(CC)/C(C)=C/C(=N\C)C1=CC(=C2CCC2)N2C=C(C3CCN(CCF)CC3)C=CC2=N1.CCC/C=C(/C)C(C)CC |
| InChI | InChI=1S/C28H37FN4.C10H20/c1-5-20(2)21(3)17-25(30-4)26-18-27(23-7-6-8-23)33-19-24(9-10-28(33)31-26)22-11-14-32(15-12-22)16-13-29;1-5-7-8-10(4)9(3)6-2/h9-10,17-19,22H,2,5-8,11-16H2,1,3-4H3;8-9H,5-7H2,1-4H3/b21-17+,30-25+;10-8- |
| InChIKey | WDMSPHQLQFZAKM-SIGMXBETSA-N |
| XLogP | 9.92 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.90 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|