C40H54N4 — CID 142510993
2-[4-cyclobutylidene-2-[(2E,4Z)-5-ethyl-6-methylhepta-2,4,6-trien-3-yl]pyrido[1,2-a]pyrimidin-7-yl]-3,4,6,7,10,10a-hexahydro-1H-pyrazino[1,2-a]azepine;(Z)-4,5-dimethylhept-3-en-1-yne (PubChem CID 142510993) has the molecular formula C40H54N4 and a molecular weight of 590.90 g/mol. Its IUPAC name is 2-[4-cyclobutylidene-2-[(2E,4Z)-5-ethyl-6-methylhepta-2,4,6-trien-3-yl]pyrido[1,2-a]pyrimidin-7-yl]-3,4,6,7,10,10a-hexahydro-1H-pyrazino[1,2-a]azepine;(Z)-4,5-dimethylhept-3-en-1-yne.
| Compound Name | 2-[4-cyclobutylidene-2-[(2E,4Z)-5-ethyl-6-methylhepta-2,4,6-trien-3-yl]pyrido[1,2-a]pyrimidin-7-yl]-3,4,6,7,10,10a-hexahydro-1H-pyrazino[1,2-a]azepine;(Z)-4,5-dimethylhept-3-en-1-yne |
|---|---|
| PubChem CID | 142510993 |
| Molecular Formula | C40H54N4 |
| Molecular Weight | 590.90 g/mol |
| Exact Mass | 590.43 |
| IUPAC Name | 2-[4-cyclobutylidene-2-[(2E,4Z)-5-ethyl-6-methylhepta-2,4,6-trien-3-yl]pyrido[1,2-a]pyrimidin-7-yl]-3,4,6,7,10,10a-hexahydro-1H-pyrazino[1,2-a]azepine;(Z)-4,5-dimethylhept-3-en-1-yne |
| SMILES | C#C/C=C(/C)C(C)CC.C=C(C)/C(=C\C(=C/C)C1=CC(=C2CCC2)N2C=C(N3CCN4CCC=CCC4C3)C=CC2=N1)CC |
| InChI | InChI=1S/C31H40N4.C9H14/c1-5-24(23(3)4)19-25(6-2)29-20-30(26-11-10-12-26)35-22-28(14-15-31(35)32-29)34-18-17-33-16-9-7-8-13-27(33)21-34;1-5-7-9(4)8(3)6-2/h6-8,14-15,19-20,22,27H,3,5,9-13,16-18,21H2,1-2,4H3;1,7-8H,6H2,2-4H3/b24-19-,25-6+;9-7- |
| InChIKey | REEYPCYXLUMAKN-LWJJPZTASA-N |
| XLogP | 9.24 |
| TPSA | 22.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.90 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|