C39H58N4 — CID 142511227
(2E)-1-[4-cyclobutylidene-7-(1-cyclobutylpiperidin-4-yl)pyrido[1,2-a]pyrimidin-2-yl]-N,3,4-trimethylpenta-2,4-dien-1-imine;(Z)-3,4-dimethyloct-4-ene (PubChem CID 142511227) has the molecular formula C39H58N4 and a molecular weight of 582.92 g/mol. Its IUPAC name is (2E)-1-[4-cyclobutylidene-7-(1-cyclobutylpiperidin-4-yl)pyrido[1,2-a]pyrimidin-2-yl]-N,3,4-trimethylpenta-2,4-dien-1-imine;(Z)-3,4-dimethyloct-4-ene.
| Compound Name | (2E)-1-[4-cyclobutylidene-7-(1-cyclobutylpiperidin-4-yl)pyrido[1,2-a]pyrimidin-2-yl]-N,3,4-trimethylpenta-2,4-dien-1-imine;(Z)-3,4-dimethyloct-4-ene |
|---|---|
| PubChem CID | 142511227 |
| Molecular Formula | C39H58N4 |
| Molecular Weight | 582.92 g/mol |
| Exact Mass | 582.47 |
| IUPAC Name | (2E)-1-[4-cyclobutylidene-7-(1-cyclobutylpiperidin-4-yl)pyrido[1,2-a]pyrimidin-2-yl]-N,3,4-trimethylpenta-2,4-dien-1-imine;(Z)-3,4-dimethyloct-4-ene |
| SMILES | C=C(C)/C(C)=C/C(=N\C)C1=CC(=C2CCC2)N2C=C(C3CCN(C4CCC4)CC3)C=CC2=N1.CCC/C=C(/C)C(C)CC |
| InChI | InChI=1S/C29H38N4.C10H20/c1-20(2)21(3)17-26(30-4)27-18-28(23-7-5-8-23)33-19-24(11-12-29(33)31-27)22-13-15-32(16-14-22)25-9-6-10-25;1-5-7-8-10(4)9(3)6-2/h11-12,17-19,22,25H,1,5-10,13-16H2,2-4H3;8-9H,5-7H2,1-4H3/b21-17+,30-26+;10-8- |
| InChIKey | AQDGNKTUAJEHPR-IZZZQLSKSA-N |
| XLogP | 10.11 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.92 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|