C37H57N5 — CID 142510967
(E)-1-[4-cyclobutylidene-7-(3-methylpiperazin-1-yl)pyrido[1,2-a]pyrimidin-2-yl]-N,3-dimethyl-4-methylidenehept-2-en-1-imine;(Z)-3,4-dimethyloct-4-ene (PubChem CID 142510967) has the molecular formula C37H57N5 and a molecular weight of 571.90 g/mol. Its IUPAC name is (E)-1-[4-cyclobutylidene-7-(3-methylpiperazin-1-yl)pyrido[1,2-a]pyrimidin-2-yl]-N,3-dimethyl-4-methylidenehept-2-en-1-imine;(Z)-3,4-dimethyloct-4-ene.
| Compound Name | (E)-1-[4-cyclobutylidene-7-(3-methylpiperazin-1-yl)pyrido[1,2-a]pyrimidin-2-yl]-N,3-dimethyl-4-methylidenehept-2-en-1-imine;(Z)-3,4-dimethyloct-4-ene |
|---|---|
| PubChem CID | 142510967 |
| Molecular Formula | C37H57N5 |
| Molecular Weight | 571.90 g/mol |
| Exact Mass | 571.46 |
| IUPAC Name | (E)-1-[4-cyclobutylidene-7-(3-methylpiperazin-1-yl)pyrido[1,2-a]pyrimidin-2-yl]-N,3-dimethyl-4-methylidenehept-2-en-1-imine;(Z)-3,4-dimethyloct-4-ene |
| SMILES | C=C(CCC)/C(C)=C/C(=N\C)C1=CC(=C2CCC2)N2C=C(N3CCNC(C)C3)C=CC2=N1.CCC/C=C(/C)C(C)CC |
| InChI | InChI=1S/C27H37N5.C10H20/c1-6-8-19(2)20(3)15-24(28-5)25-16-26(22-9-7-10-22)32-18-23(11-12-27(32)30-25)31-14-13-29-21(4)17-31;1-5-7-8-10(4)9(3)6-2/h11-12,15-16,18,21,29H,2,6-10,13-14,17H2,1,3-5H3;8-9H,5-7H2,1-4H3/b20-15+,28-24+;10-8- |
| InChIKey | OSTYJNHOVKZLAY-DXOXQZJPSA-N |
| XLogP | 8.88 |
| TPSA | 43.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.90 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|