C39H54N4 — CID 142511164
4-cyclobutylidene-7-(4-cyclobutylpiperazin-1-yl)-2-[(2E,4Z)-5-ethyl-6-methylhepta-2,4,6-trien-3-yl]pyrido[1,2-a]pyrimidine;(Z)-4,5-dimethylhept-3-en-1-yne (PubChem CID 142511164) has the molecular formula C39H54N4 and a molecular weight of 578.89 g/mol. Its IUPAC name is 4-cyclobutylidene-7-(4-cyclobutylpiperazin-1-yl)-2-[(2E,4Z)-5-ethyl-6-methylhepta-2,4,6-trien-3-yl]pyrido[1,2-a]pyrimidine;(Z)-4,5-dimethylhept-3-en-1-yne.
| Compound Name | 4-cyclobutylidene-7-(4-cyclobutylpiperazin-1-yl)-2-[(2E,4Z)-5-ethyl-6-methylhepta-2,4,6-trien-3-yl]pyrido[1,2-a]pyrimidine;(Z)-4,5-dimethylhept-3-en-1-yne |
|---|---|
| PubChem CID | 142511164 |
| Molecular Formula | C39H54N4 |
| Molecular Weight | 578.89 g/mol |
| Exact Mass | 578.43 |
| IUPAC Name | 4-cyclobutylidene-7-(4-cyclobutylpiperazin-1-yl)-2-[(2E,4Z)-5-ethyl-6-methylhepta-2,4,6-trien-3-yl]pyrido[1,2-a]pyrimidine;(Z)-4,5-dimethylhept-3-en-1-yne |
| SMILES | C#C/C=C(/C)C(C)CC.C=C(C)/C(=C\C(=C/C)C1=CC(=C2CCC2)N2C=C(N3CCN(C4CCC4)CC3)C=CC2=N1)CC |
| InChI | InChI=1S/C30H40N4.C9H14/c1-5-23(22(3)4)19-24(6-2)28-20-29(25-9-7-10-25)34-21-27(13-14-30(34)31-28)33-17-15-32(16-18-33)26-11-8-12-26;1-5-7-9(4)8(3)6-2/h6,13-14,19-21,26H,3,5,7-12,15-18H2,1-2,4H3;1,7-8H,6H2,2-4H3/b23-19-,24-6-;9-7- |
| InChIKey | SHQJWRVHDVDQFH-KZAFVWEBSA-N |
| XLogP | 9.07 |
| TPSA | 22.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.89 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|