C37H54N4 — CID 142511286
4-cyclobutylidene-7-(3,5-dimethylpiperazin-1-yl)-2-[(4E,6E,11Z)-4,12,13-trimethyl-3-methylidenepentadeca-4,6,11-trien-6-yl]pyrido[1,2-a]pyrimidine (PubChem CID 142511286) has the molecular formula C37H54N4 and a molecular weight of 554.87 g/mol. Its IUPAC name is 4-cyclobutylidene-7-(3,5-dimethylpiperazin-1-yl)-2-[(4E,6E,11Z)-4,12,13-trimethyl-3-methylidenepentadeca-4,6,11-trien-6-yl]pyrido[1,2-a]pyrimidine.
| Compound Name | 4-cyclobutylidene-7-(3,5-dimethylpiperazin-1-yl)-2-[(4E,6E,11Z)-4,12,13-trimethyl-3-methylidenepentadeca-4,6,11-trien-6-yl]pyrido[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 142511286 |
| Molecular Formula | C37H54N4 |
| Molecular Weight | 554.87 g/mol |
| Exact Mass | 554.43 |
| IUPAC Name | 4-cyclobutylidene-7-(3,5-dimethylpiperazin-1-yl)-2-[(4E,6E,11Z)-4,12,13-trimethyl-3-methylidenepentadeca-4,6,11-trien-6-yl]pyrido[1,2-a]pyrimidine |
| SMILES | C=C(CC)/C(C)=C/C(=C\CCC/C=C(/C)C(C)CC)C1=CC(=C2CCC2)N2C=C(N3CC(C)NC(C)C3)C=CC2=N1 |
| InChI | InChI=1S/C37H54N4/c1-9-26(3)28(5)15-12-11-13-16-33(21-29(6)27(4)10-2)35-22-36(32-17-14-18-32)41-25-34(19-20-37(41)39-35)40-23-30(7)38-31(8)24-40/h15-16,19-22,25-26,30-31,38H,4,9-14,17-18,23-24H2,1-3,5-8H3/b28-15-,29-21+,33-16+ |
| InChIKey | GXZBIIXVYDQHMK-DFBXAGJYSA-N |
| XLogP | 9.12 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.87 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|