C38H55N3 — CID 142511279
4-cyclobutylidene-7-(4-ethyl-4-methylpiperidin-1-yl)-2-[(3E,5E,10Z)-2,3,11,12-tetramethyltetradeca-1,3,5,10-tetraen-5-yl]pyrido[1,2-a]pyrimidine (PubChem CID 142511279) has the molecular formula C38H55N3 and a molecular weight of 553.88 g/mol. Its IUPAC name is 4-cyclobutylidene-7-(4-ethyl-4-methylpiperidin-1-yl)-2-[(3E,5E,10Z)-2,3,11,12-tetramethyltetradeca-1,3,5,10-tetraen-5-yl]pyrido[1,2-a]pyrimidine.
| Compound Name | 4-cyclobutylidene-7-(4-ethyl-4-methylpiperidin-1-yl)-2-[(3E,5E,10Z)-2,3,11,12-tetramethyltetradeca-1,3,5,10-tetraen-5-yl]pyrido[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 142511279 |
| Molecular Formula | C38H55N3 |
| Molecular Weight | 553.88 g/mol |
| Exact Mass | 553.44 |
| IUPAC Name | 4-cyclobutylidene-7-(4-ethyl-4-methylpiperidin-1-yl)-2-[(3E,5E,10Z)-2,3,11,12-tetramethyltetradeca-1,3,5,10-tetraen-5-yl]pyrido[1,2-a]pyrimidine |
| SMILES | C=C(C)/C(C)=C/C(=C\CCC/C=C(/C)C(C)CC)C1=CC(=C2CCC2)N2C=C(N3CCC(C)(CC)CC3)C=CC2=N1 |
| InChI | InChI=1S/C38H55N3/c1-9-29(5)30(6)15-12-11-13-16-33(25-31(7)28(3)4)35-26-36(32-17-14-18-32)41-27-34(19-20-37(41)39-35)40-23-21-38(8,10-2)22-24-40/h15-16,19-20,25-27,29H,3,9-14,17-18,21-24H2,1-2,4-8H3/b30-15-,31-25+,33-16+ |
| InChIKey | WTIHQZZJKSHWGP-CZJWDRHWSA-N |
| XLogP | 10.56 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.88 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|