C39H62N4 — CID 142511081
4-cyclopropylidene-2-[N-methyl-C-[(E)-2-methyl-3-methylidenepent-1-enyl]carbonimidoyl]-N-(2-methylpropyl)-N-pentylpyrido[1,2-a]pyrimidin-7-amine;(Z)-3,4-dimethyloct-4-ene (PubChem CID 142511081) has the molecular formula C39H62N4 and a molecular weight of 586.95 g/mol. Its IUPAC name is 4-cyclopropylidene-2-[N-methyl-C-[(E)-2-methyl-3-methylidenepent-1-enyl]carbonimidoyl]-N-(2-methylpropyl)-N-pentylpyrido[1,2-a]pyrimidin-7-amine;(Z)-3,4-dimethyloct-4-ene.
| Compound Name | 4-cyclopropylidene-2-[N-methyl-C-[(E)-2-methyl-3-methylidenepent-1-enyl]carbonimidoyl]-N-(2-methylpropyl)-N-pentylpyrido[1,2-a]pyrimidin-7-amine;(Z)-3,4-dimethyloct-4-ene |
|---|---|
| PubChem CID | 142511081 |
| Molecular Formula | C39H62N4 |
| Molecular Weight | 586.95 g/mol |
| Exact Mass | 586.50 |
| IUPAC Name | 4-cyclopropylidene-2-[N-methyl-C-[(E)-2-methyl-3-methylidenepent-1-enyl]carbonimidoyl]-N-(2-methylpropyl)-N-pentylpyrido[1,2-a]pyrimidin-7-amine;(Z)-3,4-dimethyloct-4-ene |
| SMILES | C=C(CC)/C(C)=C/C(=N\C)C1=CC(=C2CC2)N2C=C(N(CCCCC)CC(C)C)C=CC2=N1.CCC/C=C(/C)C(C)CC |
| InChI | InChI=1S/C29H42N4.C10H20/c1-8-10-11-16-32(19-21(3)4)25-14-15-29-31-27(18-28(24-12-13-24)33(29)20-25)26(30-7)17-23(6)22(5)9-2;1-5-7-8-10(4)9(3)6-2/h14-15,17-18,20-21H,5,8-13,16,19H2,1-4,6-7H3;8-9H,5-7H2,1-4H3/b23-17+,30-26+;10-8- |
| InChIKey | WPLPOUKCLOEZHP-FKAXRSHYSA-N |
| XLogP | 10.95 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.95 |
| LogP ≤ 5 | 10.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|