C36H54N4 — CID 142511150
(E)-1-(4-cyclopropylidene-9-methyl-7-piperidin-4-ylpyrido[1,2-a]pyrimidin-2-yl)-N,3-dimethyl-4-methylidenehex-2-en-1-imine;(Z)-3,4-dimethyloct-4-ene (PubChem CID 142511150) has the molecular formula C36H54N4 and a molecular weight of 542.86 g/mol. Its IUPAC name is (E)-1-(4-cyclopropylidene-9-methyl-7-piperidin-4-ylpyrido[1,2-a]pyrimidin-2-yl)-N,3-dimethyl-4-methylidenehex-2-en-1-imine;(Z)-3,4-dimethyloct-4-ene.
| Compound Name | (E)-1-(4-cyclopropylidene-9-methyl-7-piperidin-4-ylpyrido[1,2-a]pyrimidin-2-yl)-N,3-dimethyl-4-methylidenehex-2-en-1-imine;(Z)-3,4-dimethyloct-4-ene |
|---|---|
| PubChem CID | 142511150 |
| Molecular Formula | C36H54N4 |
| Molecular Weight | 542.86 g/mol |
| Exact Mass | 542.43 |
| IUPAC Name | (E)-1-(4-cyclopropylidene-9-methyl-7-piperidin-4-ylpyrido[1,2-a]pyrimidin-2-yl)-N,3-dimethyl-4-methylidenehex-2-en-1-imine;(Z)-3,4-dimethyloct-4-ene |
| SMILES | C=C(CC)/C(C)=C/C(=N\C)C1=CC(=C2CC2)N2C=C(C3CCNCC3)C=C(C)C2=N1.CCC/C=C(/C)C(C)CC |
| InChI | InChI=1S/C26H34N4.C10H20/c1-6-17(2)18(3)14-23(27-5)24-15-25(21-7-8-21)30-16-22(13-19(4)26(30)29-24)20-9-11-28-12-10-20;1-5-7-8-10(4)9(3)6-2/h13-16,20,28H,2,6-12H2,1,3-5H3;8-9H,5-7H2,1-4H3/b18-14+,27-23+;10-8- |
| InChIKey | WJWXSUDBHAFSAW-ZMZRNXKWSA-N |
| XLogP | 9.24 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.86 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|