C24H36N2 — CID 130374259
(7Z,9Z)-1-(3-butan-2-yl-2-methylidene-1-pyridinyl)-N,2-dimethyldodeca-7,9,11-trien-1-imine (PubChem CID 130374259) has the molecular formula C24H36N2 and a molecular weight of 352.57 g/mol. Its IUPAC name is (7Z,9Z)-1-(3-butan-2-yl-2-methylidene-1-pyridinyl)-N,2-dimethyldodeca-7,9,11-trien-1-imine.
| Compound Name | (7Z,9Z)-1-(3-butan-2-yl-2-methylidene-1-pyridinyl)-N,2-dimethyldodeca-7,9,11-trien-1-imine |
|---|---|
| PubChem CID | 130374259 |
| Molecular Formula | C24H36N2 |
| Molecular Weight | 352.57 g/mol |
| Exact Mass | 352.29 |
| IUPAC Name | (7Z,9Z)-1-(3-butan-2-yl-2-methylidene-1-pyridinyl)-N,2-dimethyldodeca-7,9,11-trien-1-imine |
| SMILES | C=C/C=C\C=C/CCCCC(C)/C(=N\C)N1C=CC=C(C(C)CC)C1=C |
| InChI | InChI=1S/C24H36N2/c1-7-9-10-11-12-13-14-15-17-21(4)24(25-6)26-19-16-18-23(22(26)5)20(3)8-2/h7,9-12,16,18-21H,1,5,8,13-15,17H2,2-4,6H3/b10-9-,12-11-,25-24+ |
| InChIKey | SCHOXGLBKLZISZ-HHBQWVABSA-N |
| XLogP | 6.83 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.57 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|