C19H27F3N2 — CID 143949812
N-buta-1,3-dien-2-yl-1-methyl-3-[6-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]piperidin-2-imine;ethane (PubChem CID 143949812) has the molecular formula C19H27F3N2 and a molecular weight of 340.43 g/mol. Its IUPAC name is N-buta-1,3-dien-2-yl-1-methyl-3-[6-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]piperidin-2-imine;ethane.
| Compound Name | N-buta-1,3-dien-2-yl-1-methyl-3-[6-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]piperidin-2-imine;ethane |
|---|---|
| PubChem CID | 143949812 |
| Molecular Formula | C19H27F3N2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | N-buta-1,3-dien-2-yl-1-methyl-3-[6-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]piperidin-2-imine;ethane |
| SMILES | C=CC(=C)/N=C1/C(C2=CCCC=C2C(F)(F)F)CCCN1C.CC |
| InChI | InChI=1S/C17H21F3N2.C2H6/c1-4-12(2)21-16-14(9-7-11-22(16)3)13-8-5-6-10-15(13)17(18,19)20;1-2/h4,8,10,14H,1-2,5-7,9,11H2,3H3;1-2H3/b21-16-; |
| InChIKey | SPZCRCBPLUOMSG-PLMZOXRSSA-N |
| XLogP | 5.66 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|