C19H27F3N2 — CID 90990693
2-[2-(2-ethylcycloocta-1,6-dien-1-yl)ethyl]-3,4-dimethyl-6-(trifluoromethyl)-4H-pyrimidine (PubChem CID 90990693) has the molecular formula C19H27F3N2 and a molecular weight of 340.43 g/mol. Its IUPAC name is 2-[2-(2-ethylcycloocta-1,6-dien-1-yl)ethyl]-3,4-dimethyl-6-(trifluoromethyl)-4H-pyrimidine.
| Compound Name | 2-[2-(2-ethylcycloocta-1,6-dien-1-yl)ethyl]-3,4-dimethyl-6-(trifluoromethyl)-4H-pyrimidine |
|---|---|
| PubChem CID | 90990693 |
| Molecular Formula | C19H27F3N2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | 2-[2-(2-ethylcycloocta-1,6-dien-1-yl)ethyl]-3,4-dimethyl-6-(trifluoromethyl)-4H-pyrimidine |
| SMILES | CCC1=C(CCC2=NC(C(F)(F)F)=CC(C)N2C)CC=CCCC1 |
| InChI | InChI=1S/C19H27F3N2/c1-4-15-9-7-5-6-8-10-16(15)11-12-18-23-17(19(20,21)22)13-14(2)24(18)3/h6,8,13-14H,4-5,7,9-12H2,1-3H3 |
| InChIKey | FSIBOHIOGHRRFU-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|