C17H21F3N2 — CID 143949813
N-buta-1,3-dien-2-yl-1-methyl-3-[6-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]piperidin-2-imine (PubChem CID 143949813) has the molecular formula C17H21F3N2 and a molecular weight of 310.36 g/mol. Its IUPAC name is N-buta-1,3-dien-2-yl-1-methyl-3-[6-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]piperidin-2-imine.
| Compound Name | N-buta-1,3-dien-2-yl-1-methyl-3-[6-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]piperidin-2-imine |
|---|---|
| PubChem CID | 143949813 |
| Molecular Formula | C17H21F3N2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | N-buta-1,3-dien-2-yl-1-methyl-3-[6-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]piperidin-2-imine |
| SMILES | C=CC(=C)/N=C1/C(C2=CCCC=C2C(F)(F)F)CCCN1C |
| InChI | InChI=1S/C17H21F3N2/c1-4-12(2)21-16-14(9-7-11-22(16)3)13-8-5-6-10-15(13)17(18,19)20/h4,8,10,14H,1-2,5-7,9,11H2,3H3/b21-16- |
| InChIKey | RNDRJWLKNMUJQW-PGMHBOJBSA-N |
| XLogP | 4.64 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|