C17H25N3 — CID 123307248
4-methyl-1-(5-methylhexyl)-8H-pyrido[2,3-b]azepin-5-imine (PubChem CID 123307248) has the molecular formula C17H25N3 and a molecular weight of 271.41 g/mol. Its IUPAC name is 4-methyl-1-(5-methylhexyl)-8H-pyrido[2,3-b]azepin-5-imine.
| Compound Name | 4-methyl-1-(5-methylhexyl)-8H-pyrido[2,3-b]azepin-5-imine |
|---|---|
| PubChem CID | 123307248 |
| Molecular Formula | C17H25N3 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | 4-methyl-1-(5-methylhexyl)-8H-pyrido[2,3-b]azepin-5-imine |
| SMILES | [H]/N=C1\C=CCN=C2C1=C(C)C=CN2CCCCC(C)C |
| InChI | InChI=1S/C17H25N3/c1-13(2)7-4-5-11-20-12-9-14(3)16-15(18)8-6-10-19-17(16)20/h6,8-9,12-13,18H,4-5,7,10-11H2,1-3H3/b18-15+ |
| InChIKey | QETCGNUDCMVQMW-OBGWFSINSA-N |
| XLogP | 3.95 |
| TPSA | 39.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|