C26H48N2 — CID 123415562
(Z)-N-(12-ethyl-8-methylpentadec-11-enyl)-N-methyl-N'-prop-1-en-2-ylbut-2-enimidamide (PubChem CID 123415562) has the molecular formula C26H48N2 and a molecular weight of 388.68 g/mol. Its IUPAC name is (Z)-N-(12-ethyl-8-methylpentadec-11-enyl)-N-methyl-N'-prop-1-en-2-ylbut-2-enimidamide.
| Compound Name | (Z)-N-(12-ethyl-8-methylpentadec-11-enyl)-N-methyl-N'-prop-1-en-2-ylbut-2-enimidamide |
|---|---|
| PubChem CID | 123415562 |
| Molecular Formula | C26H48N2 |
| Molecular Weight | 388.68 g/mol |
| Exact Mass | 388.38 |
| IUPAC Name | (Z)-N-(12-ethyl-8-methylpentadec-11-enyl)-N-methyl-N'-prop-1-en-2-ylbut-2-enimidamide |
| SMILES | C=C(C)/N=C(/C=C\C)N(C)CCCCCCCC(C)CCC=C(CC)CCC |
| InChI | InChI=1S/C26H48N2/c1-8-17-25(10-3)21-16-20-24(6)19-14-12-11-13-15-22-28(7)26(18-9-2)27-23(4)5/h9,18,21,24H,4,8,10-17,19-20,22H2,1-3,5-7H3/b18-9-,25-21?,27-26- |
| InChIKey | STHFYKAHNIDROM-OEFZLXNJSA-N |
| XLogP | 8.32 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.68 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|