C21H41N2+ — CID 91006323
6-(3,8-dimethyldecan-5-yl)-1,3-dimethyl-4-propan-2-yl-4H-pyrimidin-3-ium (PubChem CID 91006323) has the molecular formula C21H41N2+ and a molecular weight of 321.57 g/mol. Its IUPAC name is 6-(3,8-dimethyldecan-5-yl)-1,3-dimethyl-4-propan-2-yl-4H-pyrimidin-3-ium.
| Compound Name | 6-(3,8-dimethyldecan-5-yl)-1,3-dimethyl-4-propan-2-yl-4H-pyrimidin-3-ium |
|---|---|
| PubChem CID | 91006323 |
| Molecular Formula | C21H41N2+ |
| Molecular Weight | 321.57 g/mol |
| Exact Mass | 321.33 |
| IUPAC Name | 6-(3,8-dimethyldecan-5-yl)-1,3-dimethyl-4-propan-2-yl-4H-pyrimidin-3-ium |
| SMILES | CCC(C)CCC(CC(C)CC)C1=CC(C(C)C)[N+](C)=CN1C |
| InChI | InChI=1S/C21H41N2/c1-9-17(5)11-12-19(13-18(6)10-2)21-14-20(16(3)4)22(7)15-23(21)8/h14-20H,9-13H2,1-8H3/q+1 |
| InChIKey | QUTUJRPWVRMEEN-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.57 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|