C18H33N2+ — CID 91060564
3-methyl-4-[3-methyl-1-(2-methylcyclopropyl)pentyl]-6-propan-2-yl-1,6-dihydropyrimidin-3-ium (PubChem CID 91060564) has the molecular formula C18H33N2+ and a molecular weight of 277.48 g/mol. Its IUPAC name is 3-methyl-4-[3-methyl-1-(2-methylcyclopropyl)pentyl]-6-propan-2-yl-1,6-dihydropyrimidin-3-ium.
| Compound Name | 3-methyl-4-[3-methyl-1-(2-methylcyclopropyl)pentyl]-6-propan-2-yl-1,6-dihydropyrimidin-3-ium |
|---|---|
| PubChem CID | 91060564 |
| Molecular Formula | C18H33N2+ |
| Molecular Weight | 277.48 g/mol |
| Exact Mass | 277.26 |
| IUPAC Name | 3-methyl-4-[3-methyl-1-(2-methylcyclopropyl)pentyl]-6-propan-2-yl-1,6-dihydropyrimidin-3-ium |
| SMILES | CCC(C)CC(C1=CC(C(C)C)NC=[N+]1C)C1CC1C |
| InChI | InChI=1S/C18H32N2/c1-7-13(4)8-16(15-9-14(15)5)18-10-17(12(2)3)19-11-20(18)6/h10-17H,7-9H2,1-6H3/p+1 |
| InChIKey | AGXQXHKPBMYFJS-UHFFFAOYSA-O |
| XLogP | 3.88 |
| TPSA | 15.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.48 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|