C26H49N4+ — CID 163803428
diaminomethylidene-[4-[1-(4-methylcyclohex-2-en-1-yl)pentan-3-ylamino]-1-(2-pentan-2-ylcyclopropyl)pent-1-en-2-yl]azanium (PubChem CID 163803428) has the molecular formula C26H49N4+ and a molecular weight of 417.71 g/mol. Its IUPAC name is diaminomethylidene-[4-[1-(4-methylcyclohex-2-en-1-yl)pentan-3-ylamino]-1-(2-pentan-2-ylcyclopropyl)pent-1-en-2-yl]azanium.
| Compound Name | diaminomethylidene-[4-[1-(4-methylcyclohex-2-en-1-yl)pentan-3-ylamino]-1-(2-pentan-2-ylcyclopropyl)pent-1-en-2-yl]azanium |
|---|---|
| PubChem CID | 163803428 |
| Molecular Formula | C26H49N4+ |
| Molecular Weight | 417.71 g/mol |
| Exact Mass | 417.40 |
| IUPAC Name | diaminomethylidene-[4-[1-(4-methylcyclohex-2-en-1-yl)pentan-3-ylamino]-1-(2-pentan-2-ylcyclopropyl)pent-1-en-2-yl]azanium |
| SMILES | CCCC(C)C1CC1C=C(CC(C)NC(CC)CCC1C=CC(C)CC1)[NH+]=C(N)N |
| InChI | InChI=1S/C26H48N4/c1-6-8-19(4)25-17-22(25)16-24(30-26(27)28)15-20(5)29-23(7-2)14-13-21-11-9-18(3)10-12-21/h9,11,16,18-23,25,29H,6-8,10,12-15,17H2,1-5H3,(H4,27,28,30)/p+1 |
| InChIKey | NGYCXFTUHKDUPX-UHFFFAOYSA-O |
| XLogP | 3.83 |
| TPSA | 78.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.71 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|