C16H31N2+ — CID 91128171
6-ethyl-2,3-dimethyl-4-(5-methylheptan-2-yl)-1,6-dihydropyrimidin-3-ium (PubChem CID 91128171) has the molecular formula C16H31N2+ and a molecular weight of 251.44 g/mol. Its IUPAC name is 6-ethyl-2,3-dimethyl-4-(5-methylheptan-2-yl)-1,6-dihydropyrimidin-3-ium.
| Compound Name | 6-ethyl-2,3-dimethyl-4-(5-methylheptan-2-yl)-1,6-dihydropyrimidin-3-ium |
|---|---|
| PubChem CID | 91128171 |
| Molecular Formula | C16H31N2+ |
| Molecular Weight | 251.44 g/mol |
| Exact Mass | 251.25 |
| IUPAC Name | 6-ethyl-2,3-dimethyl-4-(5-methylheptan-2-yl)-1,6-dihydropyrimidin-3-ium |
| SMILES | CCC(C)CCC(C)C1=CC(CC)NC(C)=[N+]1C |
| InChI | InChI=1S/C16H30N2/c1-7-12(3)9-10-13(4)16-11-15(8-2)17-14(5)18(16)6/h11-13,15H,7-10H2,1-6H3/p+1 |
| InChIKey | MDFWNNCBNDVESB-UHFFFAOYSA-O |
| XLogP | 3.78 |
| TPSA | 15.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|