C23H40N4 — CID 143588089
N'-[(3E)-2-(cyclohexylmethylamino)-3-methyl-6-methylidenenona-1,3-dien-5-yl]-N-(ethyliminomethyl)ethanimidamide (PubChem CID 143588089) has the molecular formula C23H40N4 and a molecular weight of 372.60 g/mol. Its IUPAC name is N'-[(3E)-2-(cyclohexylmethylamino)-3-methyl-6-methylidenenona-1,3-dien-5-yl]-N-(ethyliminomethyl)ethanimidamide.
| Compound Name | N'-[(3E)-2-(cyclohexylmethylamino)-3-methyl-6-methylidenenona-1,3-dien-5-yl]-N-(ethyliminomethyl)ethanimidamide |
|---|---|
| PubChem CID | 143588089 |
| Molecular Formula | C23H40N4 |
| Molecular Weight | 372.60 g/mol |
| Exact Mass | 372.33 |
| IUPAC Name | N'-[(3E)-2-(cyclohexylmethylamino)-3-methyl-6-methylidenenona-1,3-dien-5-yl]-N-(ethyliminomethyl)ethanimidamide |
| SMILES | C=C(NCC1CCCCC1)/C(C)=C/C(/N=C(\C)N/C=N/CC)C(=C)CCC |
| InChI | InChI=1S/C23H40N4/c1-7-12-18(3)23(27-21(6)26-17-24-8-2)15-19(4)20(5)25-16-22-13-10-9-11-14-22/h15,17,22-23,25H,3,5,7-14,16H2,1-2,4,6H3,(H,24,26,27)/b19-15+ |
| InChIKey | RGDOOPXQPLGAHU-XDJHFCHBSA-N |
| XLogP | 5.40 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.60 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|