C28H37N3 — CID 143419223
N-[(3Z)-4-[6-[(4E,7E)-5-ethenyl-7-[(Z)-prop-1-enyl]cycloocta-2,4,7-trien-1-yl]-1-methyl-4H-pyrimidin-2-yl]buta-1,3-dien-2-yl]cyclohexanamine (PubChem CID 143419223) has the molecular formula C28H37N3 and a molecular weight of 415.63 g/mol. Its IUPAC name is N-[(3Z)-4-[6-[(4E,7E)-5-ethenyl-7-[(Z)-prop-1-enyl]cycloocta-2,4,7-trien-1-yl]-1-methyl-4H-pyrimidin-2-yl]buta-1,3-dien-2-yl]cyclohexanamine.
| Compound Name | N-[(3Z)-4-[6-[(4E,7E)-5-ethenyl-7-[(Z)-prop-1-enyl]cycloocta-2,4,7-trien-1-yl]-1-methyl-4H-pyrimidin-2-yl]buta-1,3-dien-2-yl]cyclohexanamine |
|---|---|
| PubChem CID | 143419223 |
| Molecular Formula | C28H37N3 |
| Molecular Weight | 415.63 g/mol |
| Exact Mass | 415.30 |
| IUPAC Name | N-[(3Z)-4-[6-[(4E,7E)-5-ethenyl-7-[(Z)-prop-1-enyl]cycloocta-2,4,7-trien-1-yl]-1-methyl-4H-pyrimidin-2-yl]buta-1,3-dien-2-yl]cyclohexanamine |
| SMILES | C=C/C1=C/C=CC(C2=CCN=C(/C=C\C(=C)NC3CCCCC3)N2C)/C=C(/C=C\C)C1 |
| InChI | InChI=1S/C28H37N3/c1-5-11-24-20-23(6-2)12-10-13-25(21-24)27-18-19-29-28(31(27)4)17-16-22(3)30-26-14-8-7-9-15-26/h5-6,10-13,16-18,21,25-26,30H,2-3,7-9,14-15,19-20H2,1,4H3/b11-5-,13-10?,17-16-,23-12-,24-21- |
| InChIKey | IZQMAJOWAPLYEP-LQSBNHPESA-N |
| XLogP | 6.40 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.63 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|