C27H51N3 — CID 145481642
N-[(E)-but-2-en-2-yl]-N'-ethyl-2-[2-(ethylamino)ethyl]-3-methylbut-2-enimidamide;(2Z,4E)-4,5-diethylocta-2,4-diene (PubChem CID 145481642) has the molecular formula C27H51N3 and a molecular weight of 417.73 g/mol. Its IUPAC name is N-[(E)-but-2-en-2-yl]-N'-ethyl-2-[2-(ethylamino)ethyl]-3-methylbut-2-enimidamide;(2Z,4E)-4,5-diethylocta-2,4-diene.
| Compound Name | N-[(E)-but-2-en-2-yl]-N'-ethyl-2-[2-(ethylamino)ethyl]-3-methylbut-2-enimidamide;(2Z,4E)-4,5-diethylocta-2,4-diene |
|---|---|
| PubChem CID | 145481642 |
| Molecular Formula | C27H51N3 |
| Molecular Weight | 417.73 g/mol |
| Exact Mass | 417.41 |
| IUPAC Name | N-[(E)-but-2-en-2-yl]-N'-ethyl-2-[2-(ethylamino)ethyl]-3-methylbut-2-enimidamide;(2Z,4E)-4,5-diethylocta-2,4-diene |
| SMILES | C/C=C(\C)N/C(=N\CC)C(CCNCC)=C(C)C.C/C=C\C(CC)=C(/CC)CCC |
| InChI | InChI=1S/C15H29N3.C12H22/c1-7-13(6)18-15(17-9-3)14(12(4)5)10-11-16-8-2;1-5-9-11(7-3)12(8-4)10-6-2/h7,16H,8-11H2,1-6H3,(H,17,18);5,9H,6-8,10H2,1-4H3/b13-7+;9-5-,12-11+ |
| InChIKey | KLSUZKUTEKQPPJ-ZLLMNFHJSA-N |
| XLogP | 7.73 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.73 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|