C20H30N2 — CID 123682734
2-methyl-8-methylidene-7-nona-3,6,8-trienyl-4-propyl-4,5-dihydro-1H-1,3-diazocine (PubChem CID 123682734) has the molecular formula C20H30N2 and a molecular weight of 298.47 g/mol. Its IUPAC name is 2-methyl-8-methylidene-7-nona-3,6,8-trienyl-4-propyl-4,5-dihydro-1H-1,3-diazocine.
| Compound Name | 2-methyl-8-methylidene-7-nona-3,6,8-trienyl-4-propyl-4,5-dihydro-1H-1,3-diazocine |
|---|---|
| PubChem CID | 123682734 |
| Molecular Formula | C20H30N2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.24 |
| IUPAC Name | 2-methyl-8-methylidene-7-nona-3,6,8-trienyl-4-propyl-4,5-dihydro-1H-1,3-diazocine |
| SMILES | C=CC=CCC=CCCC1=CCC(CCC)/N=C(/C)NC1=C |
| InChI | InChI=1S/C20H30N2/c1-5-7-8-9-10-11-12-14-19-15-16-20(13-6-2)22-18(4)21-17(19)3/h5,7-8,10-11,15,20H,1,3,6,9,12-14,16H2,2,4H3,(H,21,22) |
| InChIKey | MWNSIMHRNLMJJB-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|