C14H20N2 — CID 70875519
N-cyclohexa-1,3-dien-1-yl-N'-cyclohex-3-en-1-ylethanimidamide (PubChem CID 70875519) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is N-cyclohexa-1,3-dien-1-yl-N'-cyclohex-3-en-1-ylethanimidamide.
| Compound Name | N-cyclohexa-1,3-dien-1-yl-N'-cyclohex-3-en-1-ylethanimidamide |
|---|---|
| PubChem CID | 70875519 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | N-cyclohexa-1,3-dien-1-yl-N'-cyclohex-3-en-1-ylethanimidamide |
| SMILES | C/C(=N\C1CC=CCC1)NC1=CC=CCC1 |
| InChI | InChI=1S/C14H20N2/c1-12(15-13-8-4-2-5-9-13)16-14-10-6-3-7-11-14/h2-4,6,8,14H,5,7,9-11H2,1H3,(H,15,16) |
| InChIKey | AIAYDZBZCNECIK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|