C10H14N2 — CID 123490451
6-buta-1,3-dienyl-2,4-dimethyl-1,4-dihydropyrimidine (PubChem CID 123490451) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 6-buta-1,3-dienyl-2,4-dimethyl-1,4-dihydropyrimidine.
| Compound Name | 6-buta-1,3-dienyl-2,4-dimethyl-1,4-dihydropyrimidine |
|---|---|
| PubChem CID | 123490451 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 6-buta-1,3-dienyl-2,4-dimethyl-1,4-dihydropyrimidine |
| SMILES | C=CC=CC1=CC(C)N=C(C)N1 |
| InChI | InChI=1S/C10H14N2/c1-4-5-6-10-7-8(2)11-9(3)12-10/h4-8H,1H2,2-3H3,(H,11,12) |
| InChIKey | ALXRJOFIIJHHCD-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|