C24H32N2 — CID 90813969
(2E)-N'-(3-cyclohexa-1,3-dien-1-ylbut-3-enyl)-4-methyl-N-(4-methylcyclohexa-1,5-dien-1-yl)hexa-2,5-dienimidamide (PubChem CID 90813969) has the molecular formula C24H32N2 and a molecular weight of 348.53 g/mol. Its IUPAC name is (2E)-N'-(3-cyclohexa-1,3-dien-1-ylbut-3-enyl)-4-methyl-N-(4-methylcyclohexa-1,5-dien-1-yl)hexa-2,5-dienimidamide.
| Compound Name | (2E)-N'-(3-cyclohexa-1,3-dien-1-ylbut-3-enyl)-4-methyl-N-(4-methylcyclohexa-1,5-dien-1-yl)hexa-2,5-dienimidamide |
|---|---|
| PubChem CID | 90813969 |
| Molecular Formula | C24H32N2 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.26 |
| IUPAC Name | (2E)-N'-(3-cyclohexa-1,3-dien-1-ylbut-3-enyl)-4-methyl-N-(4-methylcyclohexa-1,5-dien-1-yl)hexa-2,5-dienimidamide |
| SMILES | C=CC(C)/C=C/C(=N\CCC(=C)C1=CC=CCC1)NC1=CCC(C)C=C1 |
| InChI | InChI=1S/C24H32N2/c1-5-19(2)13-16-24(26-23-14-11-20(3)12-15-23)25-18-17-21(4)22-9-7-6-8-10-22/h5-7,9,11,13-16,19-20H,1,4,8,10,12,17-18H2,2-3H3,(H,25,26)/b16-13+ |
| InChIKey | UQPWBZKSSGUNKQ-DTQAZKPQSA-N |
| XLogP | 6.06 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|