C18H22N2 — CID 90949376
N'-methyl-N-(2-methylcyclohepta-1,4,6-trien-1-yl)-2-(6-methylcyclohexa-2,4-dien-1-ylidene)ethanimidamide (PubChem CID 90949376) has the molecular formula C18H22N2 and a molecular weight of 266.39 g/mol. Its IUPAC name is N'-methyl-N-(2-methylcyclohepta-1,4,6-trien-1-yl)-2-(6-methylcyclohexa-2,4-dien-1-ylidene)ethanimidamide.
| Compound Name | N'-methyl-N-(2-methylcyclohepta-1,4,6-trien-1-yl)-2-(6-methylcyclohexa-2,4-dien-1-ylidene)ethanimidamide |
|---|---|
| PubChem CID | 90949376 |
| Molecular Formula | C18H22N2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | N'-methyl-N-(2-methylcyclohepta-1,4,6-trien-1-yl)-2-(6-methylcyclohexa-2,4-dien-1-ylidene)ethanimidamide |
| SMILES | C/N=C(\C=C1C=CC=CC1C)NC1=C(C)CC=CC=C1 |
| InChI | InChI=1S/C18H22N2/c1-14-9-7-8-11-16(14)13-18(19-3)20-17-12-6-4-5-10-15(17)2/h4-9,11-14H,10H2,1-3H3,(H,19,20) |
| InChIKey | WHDXVTSZBKQQJK-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|