C33H47N3 — CID 142511349
2-[(2E,4E)-5,6-dimethylhepta-2,4,6-trien-3-yl]-4-methylidene-7-(1,2,3,6-tetrahydropyridin-4-yl)pyrido[1,2-a]pyrimidine;(Z)-3,4-dimethyloct-4-ene (PubChem CID 142511349) has the molecular formula C33H47N3 and a molecular weight of 485.76 g/mol. Its IUPAC name is 2-[(2E,4E)-5,6-dimethylhepta-2,4,6-trien-3-yl]-4-methylidene-7-(1,2,3,6-tetrahydropyridin-4-yl)pyrido[1,2-a]pyrimidine;(Z)-3,4-dimethyloct-4-ene.
| Compound Name | 2-[(2E,4E)-5,6-dimethylhepta-2,4,6-trien-3-yl]-4-methylidene-7-(1,2,3,6-tetrahydropyridin-4-yl)pyrido[1,2-a]pyrimidine;(Z)-3,4-dimethyloct-4-ene |
|---|---|
| PubChem CID | 142511349 |
| Molecular Formula | C33H47N3 |
| Molecular Weight | 485.76 g/mol |
| Exact Mass | 485.38 |
| IUPAC Name | 2-[(2E,4E)-5,6-dimethylhepta-2,4,6-trien-3-yl]-4-methylidene-7-(1,2,3,6-tetrahydropyridin-4-yl)pyrido[1,2-a]pyrimidine;(Z)-3,4-dimethyloct-4-ene |
| SMILES | C=C(C)/C(C)=C/C(=C\C)C1=CC(=C)N2C=C(C3=CCNCC3)C=CC2=N1.CCC/C=C(/C)C(C)CC |
| InChI | InChI=1S/C23H27N3.C10H20/c1-6-19(13-17(4)16(2)3)22-14-18(5)26-15-21(7-8-23(26)25-22)20-9-11-24-12-10-20;1-5-7-8-10(4)9(3)6-2/h6-9,13-15,24H,2,5,10-12H2,1,3-4H3;8-9H,5-7H2,1-4H3/b17-13+,19-6+;10-8- |
| InChIKey | UARIPXACBVZVLT-LSLDISPKSA-N |
| XLogP | 8.72 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.76 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|