C27H45N3 — CID 123824883
(E)-6-amino-3-methyl-N'-[(3Z)-6-methylhepta-1,3,6-trien-2-yl]-N-(2-propan-2-ylhexa-2,4-dienyl)-N-propylhex-2-enimidamide (PubChem CID 123824883) has the molecular formula C27H45N3 and a molecular weight of 411.68 g/mol. Its IUPAC name is (E)-6-amino-3-methyl-N'-[(3Z)-6-methylhepta-1,3,6-trien-2-yl]-N-(2-propan-2-ylhexa-2,4-dienyl)-N-propylhex-2-enimidamide.
| Compound Name | (E)-6-amino-3-methyl-N'-[(3Z)-6-methylhepta-1,3,6-trien-2-yl]-N-(2-propan-2-ylhexa-2,4-dienyl)-N-propylhex-2-enimidamide |
|---|---|
| PubChem CID | 123824883 |
| Molecular Formula | C27H45N3 |
| Molecular Weight | 411.68 g/mol |
| Exact Mass | 411.36 |
| IUPAC Name | (E)-6-amino-3-methyl-N'-[(3Z)-6-methylhepta-1,3,6-trien-2-yl]-N-(2-propan-2-ylhexa-2,4-dienyl)-N-propylhex-2-enimidamide |
| SMILES | C=C(C)C/C=C\C(=C)/N=C(\C=C(/C)CCCN)N(CCC)CC(=CC=CC)C(C)C |
| InChI | InChI=1S/C27H45N3/c1-9-11-17-26(23(5)6)21-30(19-10-2)27(20-24(7)15-13-18-28)29-25(8)16-12-14-22(3)4/h9,11-12,16-17,20,23H,3,8,10,13-15,18-19,21,28H2,1-2,4-7H3/b11-9?,16-12-,24-20+,26-17?,29-27- |
| InChIKey | DDSZUYFHBWXHCE-VQRDYYNQSA-N |
| XLogP | 6.98 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.68 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|